C20H20N4O4S2 — CID 134803813
CID 134803813 (PubChem CID 134803813) has the molecular formula C20H20N4O4S2 and a molecular weight of 444.54 g/mol.
| Compound Name | CID 134803813 |
|---|---|
| PubChem CID | 134803813 |
| Molecular Formula | C20H20N4O4S2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | — |
| SMILES | COc1ccc(-c2cccc(C(=O)N3CCN([S+](=O)([O-])c4cccs4)CC3)c2)nn1 |
| InChI | InChI=1S/C20H20N4O4S2/c1-28-18-8-7-17(21-22-18)15-4-2-5-16(14-15)20(25)23-9-11-24(12-10-23)30(26,27)19-6-3-13-29-19/h2-8,13-14H,9-12H2,1H3 |
| InChIKey | DISAKCZFNKRSIW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|