C21H36N4O2 — CID 134804316
2-[(2R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-N-(3-piperidin-1-ylpropyl)acetamide (PubChem CID 134804316) has the molecular formula C21H36N4O2 and a molecular weight of 376.55 g/mol. Its IUPAC name is 2-[(2R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-N-(3-piperidin-1-ylpropyl)acetamide.
| Compound Name | 2-[(2R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-N-(3-piperidin-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 134804316 |
| Molecular Formula | C21H36N4O2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | 2-[(2R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-N-(3-piperidin-1-ylpropyl)acetamide |
| SMILES | O=C(CN1CC2CC(C1)[C@H]1CCCC(=O)N1C2)NCCCN1CCCCC1 |
| InChI | InChI=1S/C21H36N4O2/c26-20(22-8-5-11-23-9-2-1-3-10-23)16-24-13-17-12-18(15-24)19-6-4-7-21(27)25(19)14-17/h17-19H,1-16H2,(H,22,26)/t17?,18?,19-/m1/s1 |
| InChIKey | BZTPKLPYIFAFDM-CTWPCTMYSA-N |
| XLogP | 1.31 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|