C25H38N6O2 — CID 134804378
N-[3-(4-methylpiperazin-1-yl)propyl]-6-[(2R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-3-carboxamide (PubChem CID 134804378) has the molecular formula C25H38N6O2 and a molecular weight of 454.62 g/mol. Its IUPAC name is N-[3-(4-methylpiperazin-1-yl)propyl]-6-[(2R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-3-carboxamide.
| Compound Name | N-[3-(4-methylpiperazin-1-yl)propyl]-6-[(2R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134804378 |
| Molecular Formula | C25H38N6O2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | N-[3-(4-methylpiperazin-1-yl)propyl]-6-[(2R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-3-carboxamide |
| SMILES | CN1CCN(CCCNC(=O)c2ccc(N3CC4CC(C3)[C@H]3CCCC(=O)N3C4)nc2)CC1 |
| InChI | InChI=1S/C25H38N6O2/c1-28-10-12-29(13-11-28)9-3-8-26-25(33)20-6-7-23(27-15-20)30-16-19-14-21(18-30)22-4-2-5-24(32)31(22)17-19/h6-7,15,19,21-22H,2-5,8-14,16-18H2,1H3,(H,26,33)/t19?,21?,22-/m1/s1 |
| InChIKey | FUWQFDCJZCOGSC-KITAHSCOSA-N |
| XLogP | 1.29 |
| TPSA | 72.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|