C19H18ClFN4O3 — CID 134804907
(3aR,6aS)-5-[(3-chloro-4-fluorophenyl)methyl]-N-(5-methoxy-3-pyridinyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide (PubChem CID 134804907) has the molecular formula C19H18ClFN4O3 and a molecular weight of 404.83 g/mol. Its IUPAC name is (3aR,6aS)-5-[(3-chloro-4-fluorophenyl)methyl]-N-(5-methoxy-3-pyridinyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide.
| Compound Name | (3aR,6aS)-5-[(3-chloro-4-fluorophenyl)methyl]-N-(5-methoxy-3-pyridinyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide |
|---|---|
| PubChem CID | 134804907 |
| Molecular Formula | C19H18ClFN4O3 |
| Molecular Weight | 404.83 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | (3aR,6aS)-5-[(3-chloro-4-fluorophenyl)methyl]-N-(5-methoxy-3-pyridinyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide |
| SMILES | COc1cncc(NC(=O)C2=NO[C@@H]3CN(Cc4ccc(F)c(Cl)c4)C[C@H]23)c1 |
| InChI | InChI=1S/C19H18ClFN4O3/c1-27-13-5-12(6-22-7-13)23-19(26)18-14-9-25(10-17(14)28-24-18)8-11-2-3-16(21)15(20)4-11/h2-7,14,17H,8-10H2,1H3,(H,23,26)/t14-,17+/m0/s1 |
| InChIKey | OKKYHWRWPKWYLK-WMLDXEAASA-N |
| XLogP | 2.71 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.83 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |