C23H29N3O2 — CID 134805058
1,1'-dimethyl-N-(2-phenoxyethyl)spiro[2H-indole-3,3'-piperidine]-5-carboxamide (PubChem CID 134805058) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 1,1'-dimethyl-N-(2-phenoxyethyl)spiro[2H-indole-3,3'-piperidine]-5-carboxamide.
| Compound Name | 1,1'-dimethyl-N-(2-phenoxyethyl)spiro[2H-indole-3,3'-piperidine]-5-carboxamide |
|---|---|
| PubChem CID | 134805058 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 1,1'-dimethyl-N-(2-phenoxyethyl)spiro[2H-indole-3,3'-piperidine]-5-carboxamide |
| SMILES | CN1CCCC2(C1)CN(C)c1ccc(C(=O)NCCOc3ccccc3)cc12 |
| InChI | InChI=1S/C23H29N3O2/c1-25-13-6-11-23(16-25)17-26(2)21-10-9-18(15-20(21)23)22(27)24-12-14-28-19-7-4-3-5-8-19/h3-5,7-10,15H,6,11-14,16-17H2,1-2H3,(H,24,27) |
| InChIKey | BDSWSRZESNZFTJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|