C19H11FN2O2 — CID 134805135
8-(2-fluorophenyl)-2-pyridin-4-ylpyrano[2,3-c]pyridin-4-one (PubChem CID 134805135) has the molecular formula C19H11FN2O2 and a molecular weight of 318.31 g/mol. Its IUPAC name is 8-(2-fluorophenyl)-2-pyridin-4-ylpyrano[2,3-c]pyridin-4-one.
| Compound Name | 8-(2-fluorophenyl)-2-pyridin-4-ylpyrano[2,3-c]pyridin-4-one |
|---|---|
| PubChem CID | 134805135 |
| Molecular Formula | C19H11FN2O2 |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 8-(2-fluorophenyl)-2-pyridin-4-ylpyrano[2,3-c]pyridin-4-one |
| SMILES | O=c1cc(-c2ccncc2)oc2c(-c3ccccc3F)nccc12 |
| InChI | InChI=1S/C19H11FN2O2/c20-15-4-2-1-3-13(15)18-19-14(7-10-22-18)16(23)11-17(24-19)12-5-8-21-9-6-12/h1-11H |
| InChIKey | OOLFVAOBVYWUEI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |