C20H15FN4O — CID 134805251
3-benzyl-6-(3-fluoroanilino)pyrido[3,2-d]pyrimidin-4-one (PubChem CID 134805251) has the molecular formula C20H15FN4O and a molecular weight of 346.37 g/mol. Its IUPAC name is 3-benzyl-6-(3-fluoroanilino)pyrido[3,2-d]pyrimidin-4-one.
| Compound Name | 3-benzyl-6-(3-fluoroanilino)pyrido[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 134805251 |
| Molecular Formula | C20H15FN4O |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 3-benzyl-6-(3-fluoroanilino)pyrido[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2nc(Nc3cccc(F)c3)ccc2ncn1Cc1ccccc1 |
| InChI | InChI=1S/C20H15FN4O/c21-15-7-4-8-16(11-15)23-18-10-9-17-19(24-18)20(26)25(13-22-17)12-14-5-2-1-3-6-14/h1-11,13H,12H2,(H,23,24) |
| InChIKey | COFDXWJBQAIPEK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |