C22H22N4O4 — CID 134805362
N,6-bis(3,4-dimethoxyphenyl)imidazo[1,2-b]pyridazin-3-amine (PubChem CID 134805362) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is N,6-bis(3,4-dimethoxyphenyl)imidazo[1,2-b]pyridazin-3-amine.
| Compound Name | N,6-bis(3,4-dimethoxyphenyl)imidazo[1,2-b]pyridazin-3-amine |
|---|---|
| PubChem CID | 134805362 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N,6-bis(3,4-dimethoxyphenyl)imidazo[1,2-b]pyridazin-3-amine |
| SMILES | COc1ccc(Nc2cnc3ccc(-c4ccc(OC)c(OC)c4)nn23)cc1OC |
| InChI | InChI=1S/C22H22N4O4/c1-27-17-8-5-14(11-19(17)29-3)16-7-10-21-23-13-22(26(21)25-16)24-15-6-9-18(28-2)20(12-15)30-4/h5-13,24H,1-4H3 |
| InChIKey | OBVIEOOQZSSGAM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 79.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |