C19H21F2N3O3 — CID 134805550
[6-[(2,5-difluorophenyl)methyl]-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepin-2-yl]-morpholin-4-ylmethanone (PubChem CID 134805550) has the molecular formula C19H21F2N3O3 and a molecular weight of 377.39 g/mol. Its IUPAC name is [6-[(2,5-difluorophenyl)methyl]-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepin-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [6-[(2,5-difluorophenyl)methyl]-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepin-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 134805550 |
| Molecular Formula | C19H21F2N3O3 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | [6-[(2,5-difluorophenyl)methyl]-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepin-2-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1nc2c(o1)CCN(Cc1cc(F)ccc1F)CC2)N1CCOCC1 |
| InChI | InChI=1S/C19H21F2N3O3/c20-14-1-2-15(21)13(11-14)12-23-5-3-16-17(4-6-23)27-18(22-16)19(25)24-7-9-26-10-8-24/h1-2,11H,3-10,12H2 |
| InChIKey | QZFBJDGWDIZCLC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |