C21H16F2N2O2 — CID 134805573
4-benzyl-7-(3,5-difluorophenyl)-5H-pyrido[2,3-f][1,4]oxazepin-3-one (PubChem CID 134805573) has the molecular formula C21H16F2N2O2 and a molecular weight of 366.37 g/mol. Its IUPAC name is 4-benzyl-7-(3,5-difluorophenyl)-5H-pyrido[2,3-f][1,4]oxazepin-3-one.
| Compound Name | 4-benzyl-7-(3,5-difluorophenyl)-5H-pyrido[2,3-f][1,4]oxazepin-3-one |
|---|---|
| PubChem CID | 134805573 |
| Molecular Formula | C21H16F2N2O2 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 4-benzyl-7-(3,5-difluorophenyl)-5H-pyrido[2,3-f][1,4]oxazepin-3-one |
| SMILES | O=C1COc2ccc(-c3cc(F)cc(F)c3)nc2CN1Cc1ccccc1 |
| InChI | InChI=1S/C21H16F2N2O2/c22-16-8-15(9-17(23)10-16)18-6-7-20-19(24-18)12-25(21(26)13-27-20)11-14-4-2-1-3-5-14/h1-10H,11-13H2 |
| InChIKey | WNRGESOAGYKARD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |