About N-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)imidazo[1,2-b]pyridazin-3-amine
N-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)imidazo[1,2-b]pyridazin-3-amine (PubChem CID 134805696) has the molecular formula C19H13FN4O2
and a molecular weight of 348.34 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)imidazo[1,2-b]pyridazin-3-amine.
Molecular Properties
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)imidazo[1,2-b]pyridazin-3-amine |
| PubChem CID | 134805696 |
| Molecular Formula | C19H13FN4O2 |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)imidazo[1,2-b]pyridazin-3-amine |
| SMILES | Fc1ccc(-c2ccc3ncc(Nc4ccc5c(c4)OCO5)n3n2)cc1 |
| InChI | InChI=1S/C19H13FN4O2/c20-13-3-1-12(2-4-13)15-6-8-18-21-10-19(24(18)23-15)22-14-5-7-16-17(9-14)26-11-25-16/h1-10,22H,11H2 |
| InChIKey | NRKIOWJDXQDPIY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)imidazo[1,2-b]pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)imidazo[1,2-b]pyridazin-3-amine?
The IUPAC name of N-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)imidazo[1,2-b]pyridazin-3-amine (CID 134805696) is N-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)imidazo[1,2-b]pyridazin-3-amine.
What is the SMILES notation for N-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)imidazo[1,2-b]pyridazin-3-amine?
The canonical SMILES for N-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)imidazo[1,2-b]pyridazin-3-amine is Fc1ccc(-c2ccc3ncc(Nc4ccc5c(c4)OCO5)n3n2)cc1.
What is the InChIKey of N-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)imidazo[1,2-b]pyridazin-3-amine?
The InChIKey is NRKIOWJDXQDPIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13FN4O2/c20-13-3-1-12(2-4-13)15-6-8-18-21-10-19(24(18)23-15)22-14-5-7-16-17(9-14)26-11-25-16/h1-10,22H,11H2.
What are the key properties of N-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)imidazo[1,2-b]pyridazin-3-amine?
N-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)imidazo[1,2-b]pyridazin-3-amine has a molecular weight of 348.34 g/mol, XLogP of 4.01, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzodioxol-5-yl)-6-(4-fluorophenyl)imidazo[1,2-b]pyridazin-3-amine is sourced from PubChem (CID 134805696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).