About CID 134805760
CID 134805760 (PubChem CID 134805760) has the molecular formula C23H22N2O3S
and a molecular weight of 406.51 g/mol.
Molecular Properties
| Compound Name | CID 134805760 |
| PubChem CID | 134805760 |
| Molecular Formula | C23H22N2O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | — |
| SMILES | C[S+](=O)([O-])CCn1ncc2cc(OCc3cccc(-c4ccccc4)c3)ccc21 |
| InChI | InChI=1S/C23H22N2O3S/c1-29(26,27)13-12-25-23-11-10-22(15-21(23)16-24-25)28-17-18-6-5-9-20(14-18)19-7-3-2-4-8-19/h2-11,14-16H,12-13,17H2,1H3 |
| InChIKey | XSYCKWIPDQZTAH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 67.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 134805760 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134805760?
The IUPAC name of CID 134805760 (CID 134805760) is not available.
What is the SMILES notation for CID 134805760?
The canonical SMILES for CID 134805760 is C[S+](=O)([O-])CCn1ncc2cc(OCc3cccc(-c4ccccc4)c3)ccc21.
What is the InChIKey of CID 134805760?
The InChIKey is XSYCKWIPDQZTAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2O3S/c1-29(26,27)13-12-25-23-11-10-22(15-21(23)16-24-25)28-17-18-6-5-9-20(14-18)19-7-3-2-4-8-19/h2-11,14-16H,12-13,17H2,1H3.
What are the key properties of CID 134805760?
CID 134805760 has a molecular weight of 406.51 g/mol, XLogP of 4.54, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134805760 is sourced from PubChem (CID 134805760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).