C23H28N2O3 — CID 134805858
(4aS,9aS)-4-[(4-hydroxyphenyl)methyl]-7-[(3-methylphenyl)methyl]-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one (PubChem CID 134805858) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is (4aS,9aS)-4-[(4-hydroxyphenyl)methyl]-7-[(3-methylphenyl)methyl]-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one.
| Compound Name | (4aS,9aS)-4-[(4-hydroxyphenyl)methyl]-7-[(3-methylphenyl)methyl]-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one |
|---|---|
| PubChem CID | 134805858 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | (4aS,9aS)-4-[(4-hydroxyphenyl)methyl]-7-[(3-methylphenyl)methyl]-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one |
| SMILES | Cc1cccc(CN2CC[C@@H]3OCC(=O)N(Cc4ccc(O)cc4)[C@H]3CC2)c1 |
| InChI | InChI=1S/C23H28N2O3/c1-17-3-2-4-19(13-17)14-24-11-9-21-22(10-12-24)28-16-23(27)25(21)15-18-5-7-20(26)8-6-18/h2-8,13,21-22,26H,9-12,14-16H2,1H3/t21-,22-/m0/s1 |
| InChIKey | ULSFMYWDODHAPX-VXKWHMMOSA-N |
| XLogP | 3.09 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |