C23H31N3O3 — CID 134805915
6-(cyclohexylmethyl)-N-(2-phenoxyethyl)-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepine-2-carboxamide (PubChem CID 134805915) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 6-(cyclohexylmethyl)-N-(2-phenoxyethyl)-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepine-2-carboxamide.
| Compound Name | 6-(cyclohexylmethyl)-N-(2-phenoxyethyl)-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepine-2-carboxamide |
|---|---|
| PubChem CID | 134805915 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 6-(cyclohexylmethyl)-N-(2-phenoxyethyl)-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepine-2-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)c1nc2c(o1)CCN(CC1CCCCC1)CC2 |
| InChI | InChI=1S/C23H31N3O3/c27-22(24-13-16-28-19-9-5-2-6-10-19)23-25-20-11-14-26(15-12-21(20)29-23)17-18-7-3-1-4-8-18/h2,5-6,9-10,18H,1,3-4,7-8,11-17H2,(H,24,27) |
| InChIKey | FWXHAPXEYDKCGP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|