About [(2S)-2-methylpyrrolidin-1-yl]-[5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]methanone
[(2S)-2-methylpyrrolidin-1-yl]-[5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]methanone (PubChem CID 134805922) has the molecular formula C21H22N4O2
and a molecular weight of 362.43 g/mol. Its IUPAC name is [(2S)-2-methylpyrrolidin-1-yl]-[5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]methanone.
Molecular Properties
| Compound Name | [(2S)-2-methylpyrrolidin-1-yl]-[5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]methanone |
| PubChem CID | 134805922 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [(2S)-2-methylpyrrolidin-1-yl]-[5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]methanone |
| SMILES | C[C@H]1CCCN1C(=O)c1nnc(COc2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C21H22N4O2/c1-16-9-8-14-24(16)21(26)20-23-22-19(15-27-18-12-6-3-7-13-18)25(20)17-10-4-2-5-11-17/h2-7,10-13,16H,8-9,14-15H2,1H3/t16-/m0/s1 |
| InChIKey | ZCNBNAFJVOCZCZ-INIZCTEOSA-N |
| XLogP | 3.47 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2S)-2-methylpyrrolidin-1-yl]-[5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-methylpyrrolidin-1-yl]-[5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]methanone?
The IUPAC name of [(2S)-2-methylpyrrolidin-1-yl]-[5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]methanone (CID 134805922) is [(2S)-2-methylpyrrolidin-1-yl]-[5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]methanone.
What is the SMILES notation for [(2S)-2-methylpyrrolidin-1-yl]-[5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]methanone?
The canonical SMILES for [(2S)-2-methylpyrrolidin-1-yl]-[5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]methanone is C[C@H]1CCCN1C(=O)c1nnc(COc2ccccc2)n1-c1ccccc1.
What is the InChIKey of [(2S)-2-methylpyrrolidin-1-yl]-[5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]methanone?
The InChIKey is ZCNBNAFJVOCZCZ-INIZCTEOSA-N. The full InChI is InChI=1S/C21H22N4O2/c1-16-9-8-14-24(16)21(26)20-23-22-19(15-27-18-12-6-3-7-13-18)25(20)17-10-4-2-5-11-17/h2-7,10-13,16H,8-9,14-15H2,1H3/t16-/m0/s1.
What are the key properties of [(2S)-2-methylpyrrolidin-1-yl]-[5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]methanone?
[(2S)-2-methylpyrrolidin-1-yl]-[5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]methanone has a molecular weight of 362.43 g/mol, XLogP of 3.47, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-methylpyrrolidin-1-yl]-[5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]methanone is sourced from PubChem (CID 134805922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).