C24H22N6O — CID 134805968
N-(3-imidazol-1-ylpropyl)-3-(3-methyl-5-phenyl-[1,2]oxazolo[4,5-b]pyridin-7-yl)pyridin-2-amine (PubChem CID 134805968) has the molecular formula C24H22N6O and a molecular weight of 410.48 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-3-(3-methyl-5-phenyl-[1,2]oxazolo[4,5-b]pyridin-7-yl)pyridin-2-amine.
| Compound Name | N-(3-imidazol-1-ylpropyl)-3-(3-methyl-5-phenyl-[1,2]oxazolo[4,5-b]pyridin-7-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 134805968 |
| Molecular Formula | C24H22N6O |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-3-(3-methyl-5-phenyl-[1,2]oxazolo[4,5-b]pyridin-7-yl)pyridin-2-amine |
| SMILES | Cc1noc2c(-c3cccnc3NCCCn3ccnc3)cc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C24H22N6O/c1-17-22-23(31-29-17)20(15-21(28-22)18-7-3-2-4-8-18)19-9-5-10-26-24(19)27-11-6-13-30-14-12-25-16-30/h2-5,7-10,12,14-16H,6,11,13H2,1H3,(H,26,27) |
| InChIKey | DPIPEEYPKBKABO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|