About 3-(3-methyl-5-phenyl-[1,2]oxazolo[4,5-b]pyridin-7-yl)-N-propan-2-ylpyridin-2-amine
3-(3-methyl-5-phenyl-[1,2]oxazolo[4,5-b]pyridin-7-yl)-N-propan-2-ylpyridin-2-amine (PubChem CID 134805993) has the molecular formula C21H20N4O
and a molecular weight of 344.42 g/mol. Its IUPAC name is 3-(3-methyl-5-phenyl-[1,2]oxazolo[4,5-b]pyridin-7-yl)-N-propan-2-ylpyridin-2-amine.
Molecular Properties
| Compound Name | 3-(3-methyl-5-phenyl-[1,2]oxazolo[4,5-b]pyridin-7-yl)-N-propan-2-ylpyridin-2-amine |
| PubChem CID | 134805993 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 3-(3-methyl-5-phenyl-[1,2]oxazolo[4,5-b]pyridin-7-yl)-N-propan-2-ylpyridin-2-amine |
| SMILES | Cc1noc2c(-c3cccnc3NC(C)C)cc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C21H20N4O/c1-13(2)23-21-16(10-7-11-22-21)17-12-18(15-8-5-4-6-9-15)24-19-14(3)25-26-20(17)19/h4-13H,1-3H3,(H,22,23) |
| InChIKey | YBKMPHUIBIAJLX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-methyl-5-phenyl-[1,2]oxazolo[4,5-b]pyridin-7-yl)-N-propan-2-ylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methyl-5-phenyl-[1,2]oxazolo[4,5-b]pyridin-7-yl)-N-propan-2-ylpyridin-2-amine?
The IUPAC name of 3-(3-methyl-5-phenyl-[1,2]oxazolo[4,5-b]pyridin-7-yl)-N-propan-2-ylpyridin-2-amine (CID 134805993) is 3-(3-methyl-5-phenyl-[1,2]oxazolo[4,5-b]pyridin-7-yl)-N-propan-2-ylpyridin-2-amine.
What is the SMILES notation for 3-(3-methyl-5-phenyl-[1,2]oxazolo[4,5-b]pyridin-7-yl)-N-propan-2-ylpyridin-2-amine?
The canonical SMILES for 3-(3-methyl-5-phenyl-[1,2]oxazolo[4,5-b]pyridin-7-yl)-N-propan-2-ylpyridin-2-amine is Cc1noc2c(-c3cccnc3NC(C)C)cc(-c3ccccc3)nc12.
What is the InChIKey of 3-(3-methyl-5-phenyl-[1,2]oxazolo[4,5-b]pyridin-7-yl)-N-propan-2-ylpyridin-2-amine?
The InChIKey is YBKMPHUIBIAJLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4O/c1-13(2)23-21-16(10-7-11-22-21)17-12-18(15-8-5-4-6-9-15)24-19-14(3)25-26-20(17)19/h4-13H,1-3H3,(H,22,23).
What are the key properties of 3-(3-methyl-5-phenyl-[1,2]oxazolo[4,5-b]pyridin-7-yl)-N-propan-2-ylpyridin-2-amine?
3-(3-methyl-5-phenyl-[1,2]oxazolo[4,5-b]pyridin-7-yl)-N-propan-2-ylpyridin-2-amine has a molecular weight of 344.42 g/mol, XLogP of 5.08, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methyl-5-phenyl-[1,2]oxazolo[4,5-b]pyridin-7-yl)-N-propan-2-ylpyridin-2-amine is sourced from PubChem (CID 134805993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).