C22H22N4O2 — CID 134806011
4-(3,6-dihydro-2H-pyran-4-yl)-6-(1H-indazol-7-yl)-1-(2-methoxyethyl)pyrrolo[3,2-c]pyridine (PubChem CID 134806011) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 4-(3,6-dihydro-2H-pyran-4-yl)-6-(1H-indazol-7-yl)-1-(2-methoxyethyl)pyrrolo[3,2-c]pyridine.
| Compound Name | 4-(3,6-dihydro-2H-pyran-4-yl)-6-(1H-indazol-7-yl)-1-(2-methoxyethyl)pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 134806011 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 4-(3,6-dihydro-2H-pyran-4-yl)-6-(1H-indazol-7-yl)-1-(2-methoxyethyl)pyrrolo[3,2-c]pyridine |
| SMILES | COCCn1ccc2c(C3=CCOCC3)nc(-c3cccc4cn[nH]c34)cc21 |
| InChI | InChI=1S/C22H22N4O2/c1-27-12-9-26-8-5-18-20(26)13-19(24-21(18)15-6-10-28-11-7-15)17-4-2-3-16-14-23-25-22(16)17/h2-6,8,13-14H,7,9-12H2,1H3,(H,23,25) |
| InChIKey | RZANTSXLQHRISV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|