About 6-(4-fluorophenyl)-N-(2-morpholin-4-yl-4-pyridinyl)imidazo[1,2-b]pyridazin-3-amine
6-(4-fluorophenyl)-N-(2-morpholin-4-yl-4-pyridinyl)imidazo[1,2-b]pyridazin-3-amine (PubChem CID 134806032) has the molecular formula C21H19FN6O
and a molecular weight of 390.42 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-N-(2-morpholin-4-yl-4-pyridinyl)imidazo[1,2-b]pyridazin-3-amine.
Molecular Properties
| Compound Name | 6-(4-fluorophenyl)-N-(2-morpholin-4-yl-4-pyridinyl)imidazo[1,2-b]pyridazin-3-amine |
| PubChem CID | 134806032 |
| Molecular Formula | C21H19FN6O |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 6-(4-fluorophenyl)-N-(2-morpholin-4-yl-4-pyridinyl)imidazo[1,2-b]pyridazin-3-amine |
| SMILES | Fc1ccc(-c2ccc3ncc(Nc4ccnc(N5CCOCC5)c4)n3n2)cc1 |
| InChI | InChI=1S/C21H19FN6O/c22-16-3-1-15(2-4-16)18-5-6-19-24-14-21(28(19)26-18)25-17-7-8-23-20(13-17)27-9-11-29-12-10-27/h1-8,13-14H,9-12H2,(H,23,25) |
| InChIKey | IKHGGMQFUKWFGZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(4-fluorophenyl)-N-(2-morpholin-4-yl-4-pyridinyl)imidazo[1,2-b]pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-fluorophenyl)-N-(2-morpholin-4-yl-4-pyridinyl)imidazo[1,2-b]pyridazin-3-amine?
The IUPAC name of 6-(4-fluorophenyl)-N-(2-morpholin-4-yl-4-pyridinyl)imidazo[1,2-b]pyridazin-3-amine (CID 134806032) is 6-(4-fluorophenyl)-N-(2-morpholin-4-yl-4-pyridinyl)imidazo[1,2-b]pyridazin-3-amine.
What is the SMILES notation for 6-(4-fluorophenyl)-N-(2-morpholin-4-yl-4-pyridinyl)imidazo[1,2-b]pyridazin-3-amine?
The canonical SMILES for 6-(4-fluorophenyl)-N-(2-morpholin-4-yl-4-pyridinyl)imidazo[1,2-b]pyridazin-3-amine is Fc1ccc(-c2ccc3ncc(Nc4ccnc(N5CCOCC5)c4)n3n2)cc1.
What is the InChIKey of 6-(4-fluorophenyl)-N-(2-morpholin-4-yl-4-pyridinyl)imidazo[1,2-b]pyridazin-3-amine?
The InChIKey is IKHGGMQFUKWFGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19FN6O/c22-16-3-1-15(2-4-16)18-5-6-19-24-14-21(28(19)26-18)25-17-7-8-23-20(13-17)27-9-11-29-12-10-27/h1-8,13-14H,9-12H2,(H,23,25).
What are the key properties of 6-(4-fluorophenyl)-N-(2-morpholin-4-yl-4-pyridinyl)imidazo[1,2-b]pyridazin-3-amine?
6-(4-fluorophenyl)-N-(2-morpholin-4-yl-4-pyridinyl)imidazo[1,2-b]pyridazin-3-amine has a molecular weight of 390.42 g/mol, XLogP of 3.51, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-fluorophenyl)-N-(2-morpholin-4-yl-4-pyridinyl)imidazo[1,2-b]pyridazin-3-amine is sourced from PubChem (CID 134806032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).