C16H13F3N4O — CID 134806041
(3-anilino-1H-1,2,4-triazol-5-yl)-[3-(trifluoromethyl)phenyl]methanol (PubChem CID 134806041) has the molecular formula C16H13F3N4O and a molecular weight of 334.30 g/mol. Its IUPAC name is (3-anilino-1H-1,2,4-triazol-5-yl)-[3-(trifluoromethyl)phenyl]methanol.
| Compound Name | (3-anilino-1H-1,2,4-triazol-5-yl)-[3-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 134806041 |
| Molecular Formula | C16H13F3N4O |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (3-anilino-1H-1,2,4-triazol-5-yl)-[3-(trifluoromethyl)phenyl]methanol |
| SMILES | OC(c1cccc(C(F)(F)F)c1)c1nc(Nc2ccccc2)n[nH]1 |
| InChI | InChI=1S/C16H13F3N4O/c17-16(18,19)11-6-4-5-10(9-11)13(24)14-21-15(23-22-14)20-12-7-2-1-3-8-12/h1-9,13,24H,(H2,20,21,22,23) |
| InChIKey | SRFKIJVSOYVNSC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |