C26H29N3O2 — CID 134806155
3-methyl-3-(4-phenylbutyl)-N-(pyridin-4-ylmethyl)-2,4-dihydro-1,4-benzoxazine-6-carboxamide (PubChem CID 134806155) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 3-methyl-3-(4-phenylbutyl)-N-(pyridin-4-ylmethyl)-2,4-dihydro-1,4-benzoxazine-6-carboxamide.
| Compound Name | 3-methyl-3-(4-phenylbutyl)-N-(pyridin-4-ylmethyl)-2,4-dihydro-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 134806155 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 3-methyl-3-(4-phenylbutyl)-N-(pyridin-4-ylmethyl)-2,4-dihydro-1,4-benzoxazine-6-carboxamide |
| SMILES | CC1(CCCCc2ccccc2)COc2ccc(C(=O)NCc3ccncc3)cc2N1 |
| InChI | InChI=1S/C26H29N3O2/c1-26(14-6-5-9-20-7-3-2-4-8-20)19-31-24-11-10-22(17-23(24)29-26)25(30)28-18-21-12-15-27-16-13-21/h2-4,7-8,10-13,15-17,29H,5-6,9,14,18-19H2,1H3,(H,28,30) |
| InChIKey | TUQSZCZWHPUFCV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|