C23H24FN3O3 — CID 134806224
6-[(3-fluorophenyl)methyl]-N-(2-phenoxyethyl)-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepine-2-carboxamide (PubChem CID 134806224) has the molecular formula C23H24FN3O3 and a molecular weight of 409.46 g/mol. Its IUPAC name is 6-[(3-fluorophenyl)methyl]-N-(2-phenoxyethyl)-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepine-2-carboxamide.
| Compound Name | 6-[(3-fluorophenyl)methyl]-N-(2-phenoxyethyl)-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepine-2-carboxamide |
|---|---|
| PubChem CID | 134806224 |
| Molecular Formula | C23H24FN3O3 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 6-[(3-fluorophenyl)methyl]-N-(2-phenoxyethyl)-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepine-2-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)c1nc2c(o1)CCN(Cc1cccc(F)c1)CC2 |
| InChI | InChI=1S/C23H24FN3O3/c24-18-6-4-5-17(15-18)16-27-12-9-20-21(10-13-27)30-23(26-20)22(28)25-11-14-29-19-7-2-1-3-8-19/h1-8,15H,9-14,16H2,(H,25,28) |
| InChIKey | IRTMVAMZPJSVEW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|