About 4-[3-(4-phenoxyanilino)-1H-1,2,4-triazol-5-yl]oxan-4-ol
4-[3-(4-phenoxyanilino)-1H-1,2,4-triazol-5-yl]oxan-4-ol (PubChem CID 134806355) has the molecular formula C19H20N4O3
and a molecular weight of 352.39 g/mol. Its IUPAC name is 4-[3-(4-phenoxyanilino)-1H-1,2,4-triazol-5-yl]oxan-4-ol.
Molecular Properties
| Compound Name | 4-[3-(4-phenoxyanilino)-1H-1,2,4-triazol-5-yl]oxan-4-ol |
| PubChem CID | 134806355 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 4-[3-(4-phenoxyanilino)-1H-1,2,4-triazol-5-yl]oxan-4-ol |
| SMILES | OC1(c2nc(Nc3ccc(Oc4ccccc4)cc3)n[nH]2)CCOCC1 |
| InChI | InChI=1S/C19H20N4O3/c24-19(10-12-25-13-11-19)17-21-18(23-22-17)20-14-6-8-16(9-7-14)26-15-4-2-1-3-5-15/h1-9,24H,10-13H2,(H2,20,21,22,23) |
| InChIKey | QYXUUONKOWLYEO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[3-(4-phenoxyanilino)-1H-1,2,4-triazol-5-yl]oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4-phenoxyanilino)-1H-1,2,4-triazol-5-yl]oxan-4-ol?
The IUPAC name of 4-[3-(4-phenoxyanilino)-1H-1,2,4-triazol-5-yl]oxan-4-ol (CID 134806355) is 4-[3-(4-phenoxyanilino)-1H-1,2,4-triazol-5-yl]oxan-4-ol.
What is the SMILES notation for 4-[3-(4-phenoxyanilino)-1H-1,2,4-triazol-5-yl]oxan-4-ol?
The canonical SMILES for 4-[3-(4-phenoxyanilino)-1H-1,2,4-triazol-5-yl]oxan-4-ol is OC1(c2nc(Nc3ccc(Oc4ccccc4)cc3)n[nH]2)CCOCC1.
What is the InChIKey of 4-[3-(4-phenoxyanilino)-1H-1,2,4-triazol-5-yl]oxan-4-ol?
The InChIKey is QYXUUONKOWLYEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O3/c24-19(10-12-25-13-11-19)17-21-18(23-22-17)20-14-6-8-16(9-7-14)26-15-4-2-1-3-5-15/h1-9,24H,10-13H2,(H2,20,21,22,23).
What are the key properties of 4-[3-(4-phenoxyanilino)-1H-1,2,4-triazol-5-yl]oxan-4-ol?
4-[3-(4-phenoxyanilino)-1H-1,2,4-triazol-5-yl]oxan-4-ol has a molecular weight of 352.39 g/mol, XLogP of 3.34, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4-phenoxyanilino)-1H-1,2,4-triazol-5-yl]oxan-4-ol is sourced from PubChem (CID 134806355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).