C23H20N6O — CID 134806457
6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methyl-2-phenyl-N-pyrimidin-4-ylpyrrolo[3,2-c]pyridin-4-amine (PubChem CID 134806457) has the molecular formula C23H20N6O and a molecular weight of 396.45 g/mol. Its IUPAC name is 6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methyl-2-phenyl-N-pyrimidin-4-ylpyrrolo[3,2-c]pyridin-4-amine.
| Compound Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methyl-2-phenyl-N-pyrimidin-4-ylpyrrolo[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 134806457 |
| Molecular Formula | C23H20N6O |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methyl-2-phenyl-N-pyrimidin-4-ylpyrrolo[3,2-c]pyridin-4-amine |
| SMILES | Cc1noc(C)c1-c1cc2c(cc(-c3ccccc3)n2C)c(Nc2ccncn2)n1 |
| InChI | InChI=1S/C23H20N6O/c1-14-22(15(2)30-28-14)18-12-20-17(23(26-18)27-21-9-10-24-13-25-21)11-19(29(20)3)16-7-5-4-6-8-16/h4-13H,1-3H3,(H,24,25,26,27) |
| InChIKey | AOZSCVOSKCCSJW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|