C18H19N5O — CID 134806482
4-[1,2-dimethyl-4-(1-methylpyrazol-4-yl)pyrrolo[3,2-c]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole (PubChem CID 134806482) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 4-[1,2-dimethyl-4-(1-methylpyrazol-4-yl)pyrrolo[3,2-c]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[1,2-dimethyl-4-(1-methylpyrazol-4-yl)pyrrolo[3,2-c]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 134806482 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 4-[1,2-dimethyl-4-(1-methylpyrazol-4-yl)pyrrolo[3,2-c]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1-c1cc2c(cc(C)n2C)c(-c2cnn(C)c2)n1 |
| InChI | InChI=1S/C18H19N5O/c1-10-6-14-16(23(10)5)7-15(17-11(2)21-24-12(17)3)20-18(14)13-8-19-22(4)9-13/h6-9H,1-5H3 |
| InChIKey | IRBVYOICXAOFKC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 61.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|