C19H17F3N6OS — CID 134806509
(4-methyl-1,3-thiazol-5-yl)-[2-[3-(trifluoromethyl)anilino]-5,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepin-8-yl]methanone (PubChem CID 134806509) has the molecular formula C19H17F3N6OS and a molecular weight of 434.45 g/mol. Its IUPAC name is (4-methyl-1,3-thiazol-5-yl)-[2-[3-(trifluoromethyl)anilino]-5,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepin-8-yl]methanone.
| Compound Name | (4-methyl-1,3-thiazol-5-yl)-[2-[3-(trifluoromethyl)anilino]-5,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepin-8-yl]methanone |
|---|---|
| PubChem CID | 134806509 |
| Molecular Formula | C19H17F3N6OS |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | (4-methyl-1,3-thiazol-5-yl)-[2-[3-(trifluoromethyl)anilino]-5,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepin-8-yl]methanone |
| SMILES | Cc1ncsc1C(=O)N1CCNc2cnc(Nc3cccc(C(F)(F)F)c3)nc2C1 |
| InChI | InChI=1S/C19H17F3N6OS/c1-11-16(30-10-25-11)17(29)28-6-5-23-14-8-24-18(27-15(14)9-28)26-13-4-2-3-12(7-13)19(20,21)22/h2-4,7-8,10,23H,5-6,9H2,1H3,(H,24,26,27) |
| InChIKey | QLGQBJNAOVQZCK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |