C22H20F3N3O2 — CID 134806557
6-[(2,3-difluorophenyl)methyl]-N-[(3-fluorophenyl)methyl]-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepine-2-carboxamide (PubChem CID 134806557) has the molecular formula C22H20F3N3O2 and a molecular weight of 415.42 g/mol. Its IUPAC name is 6-[(2,3-difluorophenyl)methyl]-N-[(3-fluorophenyl)methyl]-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepine-2-carboxamide.
| Compound Name | 6-[(2,3-difluorophenyl)methyl]-N-[(3-fluorophenyl)methyl]-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepine-2-carboxamide |
|---|---|
| PubChem CID | 134806557 |
| Molecular Formula | C22H20F3N3O2 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 6-[(2,3-difluorophenyl)methyl]-N-[(3-fluorophenyl)methyl]-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepine-2-carboxamide |
| SMILES | O=C(NCc1cccc(F)c1)c1nc2c(o1)CCN(Cc1cccc(F)c1F)CC2 |
| InChI | InChI=1S/C22H20F3N3O2/c23-16-5-1-3-14(11-16)12-26-21(29)22-27-18-7-9-28(10-8-19(18)30-22)13-15-4-2-6-17(24)20(15)25/h1-6,11H,7-10,12-13H2,(H,26,29) |
| InChIKey | XQNUSFGKLQQMTO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |