C19H18N4O — CID 134806819
4-(1,2-dimethyl-4-pyridin-3-ylpyrrolo[3,2-c]pyridin-6-yl)-3,5-dimethyl-1,2-oxazole (PubChem CID 134806819) has the molecular formula C19H18N4O and a molecular weight of 318.38 g/mol. Its IUPAC name is 4-(1,2-dimethyl-4-pyridin-3-ylpyrrolo[3,2-c]pyridin-6-yl)-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-(1,2-dimethyl-4-pyridin-3-ylpyrrolo[3,2-c]pyridin-6-yl)-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 134806819 |
| Molecular Formula | C19H18N4O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 4-(1,2-dimethyl-4-pyridin-3-ylpyrrolo[3,2-c]pyridin-6-yl)-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1-c1cc2c(cc(C)n2C)c(-c2cccnc2)n1 |
| InChI | InChI=1S/C19H18N4O/c1-11-8-15-17(23(11)4)9-16(18-12(2)22-24-13(18)3)21-19(15)14-6-5-7-20-10-14/h5-10H,1-4H3 |
| InChIKey | WBNWJELBKXCZPS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|