C22H26N2O3 — CID 134806858
(4aS,9aS)-4-benzyl-7-[(2-hydroxyphenyl)methyl]-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one (PubChem CID 134806858) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is (4aS,9aS)-4-benzyl-7-[(2-hydroxyphenyl)methyl]-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one.
| Compound Name | (4aS,9aS)-4-benzyl-7-[(2-hydroxyphenyl)methyl]-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one |
|---|---|
| PubChem CID | 134806858 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (4aS,9aS)-4-benzyl-7-[(2-hydroxyphenyl)methyl]-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one |
| SMILES | O=C1CO[C@H]2CCN(Cc3ccccc3O)CC[C@@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C22H26N2O3/c25-20-9-5-4-8-18(20)15-23-12-10-19-21(11-13-23)27-16-22(26)24(19)14-17-6-2-1-3-7-17/h1-9,19,21,25H,10-16H2/t19-,21-/m0/s1 |
| InChIKey | NVNHIPXBOLYSKQ-FPOVZHCZSA-N |
| XLogP | 2.78 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|