C23H23F2N3O3 — CID 134806925
6-[(2,6-difluorophenyl)methyl]-N-(2-phenoxyethyl)-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepine-2-carboxamide (PubChem CID 134806925) has the molecular formula C23H23F2N3O3 and a molecular weight of 427.45 g/mol. Its IUPAC name is 6-[(2,6-difluorophenyl)methyl]-N-(2-phenoxyethyl)-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepine-2-carboxamide.
| Compound Name | 6-[(2,6-difluorophenyl)methyl]-N-(2-phenoxyethyl)-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepine-2-carboxamide |
|---|---|
| PubChem CID | 134806925 |
| Molecular Formula | C23H23F2N3O3 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 6-[(2,6-difluorophenyl)methyl]-N-(2-phenoxyethyl)-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepine-2-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)c1nc2c(o1)CCN(Cc1c(F)cccc1F)CC2 |
| InChI | InChI=1S/C23H23F2N3O3/c24-18-7-4-8-19(25)17(18)15-28-12-9-20-21(10-13-28)31-23(27-20)22(29)26-11-14-30-16-5-2-1-3-6-16/h1-8H,9-15H2,(H,26,29) |
| InChIKey | HRVKYJQJCTXULK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|