About [3-[3-methyl-5-[3-(trifluoromethyl)phenyl]-[1,2]oxazolo[4,5-b]pyridin-7-yl]phenyl]methanol
[3-[3-methyl-5-[3-(trifluoromethyl)phenyl]-[1,2]oxazolo[4,5-b]pyridin-7-yl]phenyl]methanol (PubChem CID 134806963) has the molecular formula C21H15F3N2O2
and a molecular weight of 384.36 g/mol. Its IUPAC name is [3-[3-methyl-5-[3-(trifluoromethyl)phenyl]-[1,2]oxazolo[4,5-b]pyridin-7-yl]phenyl]methanol.
Molecular Properties
| Compound Name | [3-[3-methyl-5-[3-(trifluoromethyl)phenyl]-[1,2]oxazolo[4,5-b]pyridin-7-yl]phenyl]methanol |
| PubChem CID | 134806963 |
| Molecular Formula | C21H15F3N2O2 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | [3-[3-methyl-5-[3-(trifluoromethyl)phenyl]-[1,2]oxazolo[4,5-b]pyridin-7-yl]phenyl]methanol |
| SMILES | Cc1noc2c(-c3cccc(CO)c3)cc(-c3cccc(C(F)(F)F)c3)nc12 |
| InChI | InChI=1S/C21H15F3N2O2/c1-12-19-20(28-26-12)17(14-5-2-4-13(8-14)11-27)10-18(25-19)15-6-3-7-16(9-15)21(22,23)24/h2-10,27H,11H2,1H3 |
| InChIKey | ARUTTWVPLJQZJM-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[3-methyl-5-[3-(trifluoromethyl)phenyl]-[1,2]oxazolo[4,5-b]pyridin-7-yl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[3-methyl-5-[3-(trifluoromethyl)phenyl]-[1,2]oxazolo[4,5-b]pyridin-7-yl]phenyl]methanol?
The IUPAC name of [3-[3-methyl-5-[3-(trifluoromethyl)phenyl]-[1,2]oxazolo[4,5-b]pyridin-7-yl]phenyl]methanol (CID 134806963) is [3-[3-methyl-5-[3-(trifluoromethyl)phenyl]-[1,2]oxazolo[4,5-b]pyridin-7-yl]phenyl]methanol.
What is the SMILES notation for [3-[3-methyl-5-[3-(trifluoromethyl)phenyl]-[1,2]oxazolo[4,5-b]pyridin-7-yl]phenyl]methanol?
The canonical SMILES for [3-[3-methyl-5-[3-(trifluoromethyl)phenyl]-[1,2]oxazolo[4,5-b]pyridin-7-yl]phenyl]methanol is Cc1noc2c(-c3cccc(CO)c3)cc(-c3cccc(C(F)(F)F)c3)nc12.
What is the InChIKey of [3-[3-methyl-5-[3-(trifluoromethyl)phenyl]-[1,2]oxazolo[4,5-b]pyridin-7-yl]phenyl]methanol?
The InChIKey is ARUTTWVPLJQZJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15F3N2O2/c1-12-19-20(28-26-12)17(14-5-2-4-13(8-14)11-27)10-18(25-19)15-6-3-7-16(9-15)21(22,23)24/h2-10,27H,11H2,1H3.
What are the key properties of [3-[3-methyl-5-[3-(trifluoromethyl)phenyl]-[1,2]oxazolo[4,5-b]pyridin-7-yl]phenyl]methanol?
[3-[3-methyl-5-[3-(trifluoromethyl)phenyl]-[1,2]oxazolo[4,5-b]pyridin-7-yl]phenyl]methanol has a molecular weight of 384.36 g/mol, XLogP of 5.38, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[3-methyl-5-[3-(trifluoromethyl)phenyl]-[1,2]oxazolo[4,5-b]pyridin-7-yl]phenyl]methanol is sourced from PubChem (CID 134806963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).