C18H15FN2O3 — CID 134807655
8-(4-fluorophenyl)-2-morpholin-4-ylpyrano[2,3-c]pyridin-4-one (PubChem CID 134807655) has the molecular formula C18H15FN2O3 and a molecular weight of 326.33 g/mol. Its IUPAC name is 8-(4-fluorophenyl)-2-morpholin-4-ylpyrano[2,3-c]pyridin-4-one.
| Compound Name | 8-(4-fluorophenyl)-2-morpholin-4-ylpyrano[2,3-c]pyridin-4-one |
|---|---|
| PubChem CID | 134807655 |
| Molecular Formula | C18H15FN2O3 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 8-(4-fluorophenyl)-2-morpholin-4-ylpyrano[2,3-c]pyridin-4-one |
| SMILES | O=c1cc(N2CCOCC2)oc2c(-c3ccc(F)cc3)nccc12 |
| InChI | InChI=1S/C18H15FN2O3/c19-13-3-1-12(2-4-13)17-18-14(5-6-20-17)15(22)11-16(24-18)21-7-9-23-10-8-21/h1-6,11H,7-10H2 |
| InChIKey | HMYWQQNHZFTTSE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |