C20H24N6O — CID 134807929
6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(3-imidazol-1-ylpropyl)-1,2-dimethylpyrrolo[3,2-c]pyridin-4-amine (PubChem CID 134807929) has the molecular formula C20H24N6O and a molecular weight of 364.45 g/mol. Its IUPAC name is 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(3-imidazol-1-ylpropyl)-1,2-dimethylpyrrolo[3,2-c]pyridin-4-amine.
| Compound Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(3-imidazol-1-ylpropyl)-1,2-dimethylpyrrolo[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 134807929 |
| Molecular Formula | C20H24N6O |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(3-imidazol-1-ylpropyl)-1,2-dimethylpyrrolo[3,2-c]pyridin-4-amine |
| SMILES | Cc1noc(C)c1-c1cc2c(cc(C)n2C)c(NCCCn2ccnc2)n1 |
| InChI | InChI=1S/C20H24N6O/c1-13-10-16-18(25(13)4)11-17(19-14(2)24-27-15(19)3)23-20(16)22-6-5-8-26-9-7-21-12-26/h7,9-12H,5-6,8H2,1-4H3,(H,22,23) |
| InChIKey | HWZYYHQJERKFTQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|