C22H24ClN5O2 — CID 134807968
7-[(3-chloro-4-pyridinyl)methyl]-N-(2-phenoxyethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-3-carboxamide (PubChem CID 134807968) has the molecular formula C22H24ClN5O2 and a molecular weight of 425.92 g/mol. Its IUPAC name is 7-[(3-chloro-4-pyridinyl)methyl]-N-(2-phenoxyethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-3-carboxamide.
| Compound Name | 7-[(3-chloro-4-pyridinyl)methyl]-N-(2-phenoxyethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-3-carboxamide |
|---|---|
| PubChem CID | 134807968 |
| Molecular Formula | C22H24ClN5O2 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 7-[(3-chloro-4-pyridinyl)methyl]-N-(2-phenoxyethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-3-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)c1cnc2n1CCN(Cc1ccncc1Cl)CC2 |
| InChI | InChI=1S/C22H24ClN5O2/c23-19-14-24-8-6-17(19)16-27-10-7-21-26-15-20(28(21)12-11-27)22(29)25-9-13-30-18-4-2-1-3-5-18/h1-6,8,14-15H,7,9-13,16H2,(H,25,29) |
| InChIKey | RQMWNWLMQWPFQW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|