C18H24N4O — CID 134808008
4-benzyl-N-(2-methoxyethyl)-1,2,3,5-tetrahydropyrido[4,3-e][1,4]diazepin-8-amine (PubChem CID 134808008) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 4-benzyl-N-(2-methoxyethyl)-1,2,3,5-tetrahydropyrido[4,3-e][1,4]diazepin-8-amine.
| Compound Name | 4-benzyl-N-(2-methoxyethyl)-1,2,3,5-tetrahydropyrido[4,3-e][1,4]diazepin-8-amine |
|---|---|
| PubChem CID | 134808008 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 4-benzyl-N-(2-methoxyethyl)-1,2,3,5-tetrahydropyrido[4,3-e][1,4]diazepin-8-amine |
| SMILES | COCCNc1cc2c(cn1)CN(Cc1ccccc1)CCN2 |
| InChI | InChI=1S/C18H24N4O/c1-23-10-8-20-18-11-17-16(12-21-18)14-22(9-7-19-17)13-15-5-3-2-4-6-15/h2-6,11-12,19H,7-10,13-14H2,1H3,(H,20,21) |
| InChIKey | XCICIIZXGHLISP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|