C22H23N3O3 — CID 134808195
4-[4-(2,3-dimethoxyphenyl)-1,2-dimethylpyrrolo[3,2-c]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole (PubChem CID 134808195) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 4-[4-(2,3-dimethoxyphenyl)-1,2-dimethylpyrrolo[3,2-c]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[4-(2,3-dimethoxyphenyl)-1,2-dimethylpyrrolo[3,2-c]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 134808195 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 4-[4-(2,3-dimethoxyphenyl)-1,2-dimethylpyrrolo[3,2-c]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole |
| SMILES | COc1cccc(-c2nc(-c3c(C)noc3C)cc3c2cc(C)n3C)c1OC |
| InChI | InChI=1S/C22H23N3O3/c1-12-10-16-18(25(12)4)11-17(20-13(2)24-28-14(20)3)23-21(16)15-8-7-9-19(26-5)22(15)27-6/h7-11H,1-6H3 |
| InChIKey | HMUHMULSTBIYAE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 62.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|