About 3-methyl-6-[3-(trifluoromethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one
3-methyl-6-[3-(trifluoromethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one (PubChem CID 134808333) has the molecular formula C15H10F3N3O
and a molecular weight of 305.26 g/mol. Its IUPAC name is 3-methyl-6-[3-(trifluoromethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-methyl-6-[3-(trifluoromethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one |
| PubChem CID | 134808333 |
| Molecular Formula | C15H10F3N3O |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 3-methyl-6-[3-(trifluoromethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one |
| SMILES | Cn1cnc2ccc(-c3cccc(C(F)(F)F)c3)nc2c1=O |
| InChI | InChI=1S/C15H10F3N3O/c1-21-8-19-12-6-5-11(20-13(12)14(21)22)9-3-2-4-10(7-9)15(16,17)18/h2-8H,1H3 |
| InChIKey | ZACGOSFWAKQSKC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-6-[3-(trifluoromethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6-[3-(trifluoromethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one?
The IUPAC name of 3-methyl-6-[3-(trifluoromethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one (CID 134808333) is 3-methyl-6-[3-(trifluoromethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 3-methyl-6-[3-(trifluoromethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one?
The canonical SMILES for 3-methyl-6-[3-(trifluoromethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one is Cn1cnc2ccc(-c3cccc(C(F)(F)F)c3)nc2c1=O.
What is the InChIKey of 3-methyl-6-[3-(trifluoromethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one?
The InChIKey is ZACGOSFWAKQSKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F3N3O/c1-21-8-19-12-6-5-11(20-13(12)14(21)22)9-3-2-4-10(7-9)15(16,17)18/h2-8H,1H3.
What are the key properties of 3-methyl-6-[3-(trifluoromethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one?
3-methyl-6-[3-(trifluoromethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one has a molecular weight of 305.26 g/mol, XLogP of 3.01, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6-[3-(trifluoromethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 134808333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).