C19H21N5O2 — CID 134808377
(3aR,6aS)-N-[3-(dimethylamino)phenyl]-5-pyridin-3-yl-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide (PubChem CID 134808377) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is (3aR,6aS)-N-[3-(dimethylamino)phenyl]-5-pyridin-3-yl-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide.
| Compound Name | (3aR,6aS)-N-[3-(dimethylamino)phenyl]-5-pyridin-3-yl-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide |
|---|---|
| PubChem CID | 134808377 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | (3aR,6aS)-N-[3-(dimethylamino)phenyl]-5-pyridin-3-yl-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide |
| SMILES | CN(C)c1cccc(NC(=O)C2=NO[C@@H]3CN(c4cccnc4)C[C@H]23)c1 |
| InChI | InChI=1S/C19H21N5O2/c1-23(2)14-6-3-5-13(9-14)21-19(25)18-16-11-24(12-17(16)26-22-18)15-7-4-8-20-10-15/h3-10,16-17H,11-12H2,1-2H3,(H,21,25)/t16-,17+/m0/s1 |
| InChIKey | GAVNUGOGTHCAQF-DLBZAZTESA-N |
| XLogP | 1.98 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |