About 5-methoxy-6-phenylmethoxy-1'-pyridin-2-ylspiro[1H-indole-3,4'-piperidine]-2-one
5-methoxy-6-phenylmethoxy-1'-pyridin-2-ylspiro[1H-indole-3,4'-piperidine]-2-one (PubChem CID 134808550) has the molecular formula C25H25N3O3
and a molecular weight of 415.49 g/mol. Its IUPAC name is 5-methoxy-6-phenylmethoxy-1'-pyridin-2-ylspiro[1H-indole-3,4'-piperidine]-2-one.
Molecular Properties
| Compound Name | 5-methoxy-6-phenylmethoxy-1'-pyridin-2-ylspiro[1H-indole-3,4'-piperidine]-2-one |
| PubChem CID | 134808550 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 5-methoxy-6-phenylmethoxy-1'-pyridin-2-ylspiro[1H-indole-3,4'-piperidine]-2-one |
| SMILES | COc1cc2c(cc1OCc1ccccc1)NC(=O)C21CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C25H25N3O3/c1-30-21-15-19-20(16-22(21)31-17-18-7-3-2-4-8-18)27-24(29)25(19)10-13-28(14-11-25)23-9-5-6-12-26-23/h2-9,12,15-16H,10-11,13-14,17H2,1H3,(H,27,29) |
| InChIKey | QUXFDDQGINNXDR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methoxy-6-phenylmethoxy-1'-pyridin-2-ylspiro[1H-indole-3,4'-piperidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-6-phenylmethoxy-1'-pyridin-2-ylspiro[1H-indole-3,4'-piperidine]-2-one?
The IUPAC name of 5-methoxy-6-phenylmethoxy-1'-pyridin-2-ylspiro[1H-indole-3,4'-piperidine]-2-one (CID 134808550) is 5-methoxy-6-phenylmethoxy-1'-pyridin-2-ylspiro[1H-indole-3,4'-piperidine]-2-one.
What is the SMILES notation for 5-methoxy-6-phenylmethoxy-1'-pyridin-2-ylspiro[1H-indole-3,4'-piperidine]-2-one?
The canonical SMILES for 5-methoxy-6-phenylmethoxy-1'-pyridin-2-ylspiro[1H-indole-3,4'-piperidine]-2-one is COc1cc2c(cc1OCc1ccccc1)NC(=O)C21CCN(c2ccccn2)CC1.
What is the InChIKey of 5-methoxy-6-phenylmethoxy-1'-pyridin-2-ylspiro[1H-indole-3,4'-piperidine]-2-one?
The InChIKey is QUXFDDQGINNXDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25N3O3/c1-30-21-15-19-20(16-22(21)31-17-18-7-3-2-4-8-18)27-24(29)25(19)10-13-28(14-11-25)23-9-5-6-12-26-23/h2-9,12,15-16H,10-11,13-14,17H2,1H3,(H,27,29).
What are the key properties of 5-methoxy-6-phenylmethoxy-1'-pyridin-2-ylspiro[1H-indole-3,4'-piperidine]-2-one?
5-methoxy-6-phenylmethoxy-1'-pyridin-2-ylspiro[1H-indole-3,4'-piperidine]-2-one has a molecular weight of 415.49 g/mol, XLogP of 4.16, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-6-phenylmethoxy-1'-pyridin-2-ylspiro[1H-indole-3,4'-piperidine]-2-one is sourced from PubChem (CID 134808550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).