C15H16F3N5O2S — CID 134808579
CID 134808579 (PubChem CID 134808579) has the molecular formula C15H16F3N5O2S and a molecular weight of 387.39 g/mol.
| Compound Name | CID 134808579 |
|---|---|
| PubChem CID | 134808579 |
| Molecular Formula | C15H16F3N5O2S |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | — |
| SMILES | C[S+](=O)([O-])N1CCNc2cnc(Nc3cccc(C(F)(F)F)c3)nc2C1 |
| InChI | InChI=1S/C15H16F3N5O2S/c1-26(24,25)23-6-5-19-12-8-20-14(22-13(12)9-23)21-11-4-2-3-10(7-11)15(16,17)18/h2-4,7-8,19H,5-6,9H2,1H3,(H-,20,21,22,24,25) |
| InChIKey | BGYKWEQUHZBZNG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|