C21H25N3O4 — CID 134808934
[6-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepin-2-yl]-morpholin-4-ylmethanone (PubChem CID 134808934) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is [6-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepin-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [6-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepin-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 134808934 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | [6-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepin-2-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1nc2c(o1)CCN(Cc1ccc3c(c1)CCO3)CC2)N1CCOCC1 |
| InChI | InChI=1S/C21H25N3O4/c25-21(24-8-11-26-12-9-24)20-22-17-3-6-23(7-4-19(17)28-20)14-15-1-2-18-16(13-15)5-10-27-18/h1-2,13H,3-12,14H2 |
| InChIKey | JUYZTQVVTGTAIS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 68.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |