About 7-(3-fluoroanilino)-4-(2-phenoxyethyl)-5H-pyrido[2,3-f][1,4]oxazepin-3-one
7-(3-fluoroanilino)-4-(2-phenoxyethyl)-5H-pyrido[2,3-f][1,4]oxazepin-3-one (PubChem CID 134808969) has the molecular formula C22H20FN3O3
and a molecular weight of 393.42 g/mol. Its IUPAC name is 7-(3-fluoroanilino)-4-(2-phenoxyethyl)-5H-pyrido[2,3-f][1,4]oxazepin-3-one.
Molecular Properties
| Compound Name | 7-(3-fluoroanilino)-4-(2-phenoxyethyl)-5H-pyrido[2,3-f][1,4]oxazepin-3-one |
| PubChem CID | 134808969 |
| Molecular Formula | C22H20FN3O3 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 7-(3-fluoroanilino)-4-(2-phenoxyethyl)-5H-pyrido[2,3-f][1,4]oxazepin-3-one |
| SMILES | O=C1COc2ccc(Nc3cccc(F)c3)nc2CN1CCOc1ccccc1 |
| InChI | InChI=1S/C22H20FN3O3/c23-16-5-4-6-17(13-16)24-21-10-9-20-19(25-21)14-26(22(27)15-29-20)11-12-28-18-7-2-1-3-8-18/h1-10,13H,11-12,14-15H2,(H,24,25) |
| InChIKey | NAFYHJJKIZZSNH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(3-fluoroanilino)-4-(2-phenoxyethyl)-5H-pyrido[2,3-f][1,4]oxazepin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-fluoroanilino)-4-(2-phenoxyethyl)-5H-pyrido[2,3-f][1,4]oxazepin-3-one?
The IUPAC name of 7-(3-fluoroanilino)-4-(2-phenoxyethyl)-5H-pyrido[2,3-f][1,4]oxazepin-3-one (CID 134808969) is 7-(3-fluoroanilino)-4-(2-phenoxyethyl)-5H-pyrido[2,3-f][1,4]oxazepin-3-one.
What is the SMILES notation for 7-(3-fluoroanilino)-4-(2-phenoxyethyl)-5H-pyrido[2,3-f][1,4]oxazepin-3-one?
The canonical SMILES for 7-(3-fluoroanilino)-4-(2-phenoxyethyl)-5H-pyrido[2,3-f][1,4]oxazepin-3-one is O=C1COc2ccc(Nc3cccc(F)c3)nc2CN1CCOc1ccccc1.
What is the InChIKey of 7-(3-fluoroanilino)-4-(2-phenoxyethyl)-5H-pyrido[2,3-f][1,4]oxazepin-3-one?
The InChIKey is NAFYHJJKIZZSNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20FN3O3/c23-16-5-4-6-17(13-16)24-21-10-9-20-19(25-21)14-26(22(27)15-29-20)11-12-28-18-7-2-1-3-8-18/h1-10,13H,11-12,14-15H2,(H,24,25).
What are the key properties of 7-(3-fluoroanilino)-4-(2-phenoxyethyl)-5H-pyrido[2,3-f][1,4]oxazepin-3-one?
7-(3-fluoroanilino)-4-(2-phenoxyethyl)-5H-pyrido[2,3-f][1,4]oxazepin-3-one has a molecular weight of 393.42 g/mol, XLogP of 3.76, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-fluoroanilino)-4-(2-phenoxyethyl)-5H-pyrido[2,3-f][1,4]oxazepin-3-one is sourced from PubChem (CID 134808969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).