C31H34N2O5S — CID 134809148
CID 134809148 (PubChem CID 134809148) has the molecular formula C31H34N2O5S and a molecular weight of 546.69 g/mol.
| Compound Name | CID 134809148 |
|---|---|
| PubChem CID | 134809148 |
| Molecular Formula | C31H34N2O5S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | — |
| SMILES | COc1cc2c(cc1CCc1ccccc1)N([S+](=O)([O-])c1ccc3c(c1)CCO3)CC21CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C31H34N2O5S/c1-22(34)32-15-13-31(14-16-32)21-33(39(35,36)26-10-11-29-25(18-26)12-17-38-29)28-19-24(30(37-2)20-27(28)31)9-8-23-6-4-3-5-7-23/h3-7,10-11,18-20H,8-9,12-17,21H2,1-2H3 |
| InChIKey | TUJQTSCRNRXWPI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|