About N-(1,3-benzodioxol-5-yl)-6-(2-methoxyphenyl)imidazo[1,2-b]pyridazin-3-amine
N-(1,3-benzodioxol-5-yl)-6-(2-methoxyphenyl)imidazo[1,2-b]pyridazin-3-amine (PubChem CID 134809356) has the molecular formula C20H16N4O3
and a molecular weight of 360.37 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-(2-methoxyphenyl)imidazo[1,2-b]pyridazin-3-amine.
Molecular Properties
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-(2-methoxyphenyl)imidazo[1,2-b]pyridazin-3-amine |
| PubChem CID | 134809356 |
| Molecular Formula | C20H16N4O3 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-(2-methoxyphenyl)imidazo[1,2-b]pyridazin-3-amine |
| SMILES | COc1ccccc1-c1ccc2ncc(Nc3ccc4c(c3)OCO4)n2n1 |
| InChI | InChI=1S/C20H16N4O3/c1-25-16-5-3-2-4-14(16)15-7-9-19-21-11-20(24(19)23-15)22-13-6-8-17-18(10-13)27-12-26-17/h2-11,22H,12H2,1H3 |
| InChIKey | YDIVJZYLXNYUFY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(1,3-benzodioxol-5-yl)-6-(2-methoxyphenyl)imidazo[1,2-b]pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzodioxol-5-yl)-6-(2-methoxyphenyl)imidazo[1,2-b]pyridazin-3-amine?
The IUPAC name of N-(1,3-benzodioxol-5-yl)-6-(2-methoxyphenyl)imidazo[1,2-b]pyridazin-3-amine (CID 134809356) is N-(1,3-benzodioxol-5-yl)-6-(2-methoxyphenyl)imidazo[1,2-b]pyridazin-3-amine.
What is the SMILES notation for N-(1,3-benzodioxol-5-yl)-6-(2-methoxyphenyl)imidazo[1,2-b]pyridazin-3-amine?
The canonical SMILES for N-(1,3-benzodioxol-5-yl)-6-(2-methoxyphenyl)imidazo[1,2-b]pyridazin-3-amine is COc1ccccc1-c1ccc2ncc(Nc3ccc4c(c3)OCO4)n2n1.
What is the InChIKey of N-(1,3-benzodioxol-5-yl)-6-(2-methoxyphenyl)imidazo[1,2-b]pyridazin-3-amine?
The InChIKey is YDIVJZYLXNYUFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N4O3/c1-25-16-5-3-2-4-14(16)15-7-9-19-21-11-20(24(19)23-15)22-13-6-8-17-18(10-13)27-12-26-17/h2-11,22H,12H2,1H3.
What are the key properties of N-(1,3-benzodioxol-5-yl)-6-(2-methoxyphenyl)imidazo[1,2-b]pyridazin-3-amine?
N-(1,3-benzodioxol-5-yl)-6-(2-methoxyphenyl)imidazo[1,2-b]pyridazin-3-amine has a molecular weight of 360.37 g/mol, XLogP of 3.88, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzodioxol-5-yl)-6-(2-methoxyphenyl)imidazo[1,2-b]pyridazin-3-amine is sourced from PubChem (CID 134809356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).