About N-[3-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-3-oxo-1H-isoindol-4-yl]phenyl]acetamide
N-[3-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-3-oxo-1H-isoindol-4-yl]phenyl]acetamide (PubChem CID 134809395) has the molecular formula C22H21N3O3
and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[3-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-3-oxo-1H-isoindol-4-yl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[3-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-3-oxo-1H-isoindol-4-yl]phenyl]acetamide |
| PubChem CID | 134809395 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[3-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-3-oxo-1H-isoindol-4-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-c2cc(-c3c(C)noc3C)cc3c2C(=O)N(C)C3)c1 |
| InChI | InChI=1S/C22H21N3O3/c1-12-20(13(2)28-24-12)16-8-17-11-25(4)22(27)21(17)19(10-16)15-6-5-7-18(9-15)23-14(3)26/h5-10H,11H2,1-4H3,(H,23,26) |
| InChIKey | SCMVYKVAJXXRNC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-3-oxo-1H-isoindol-4-yl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-3-oxo-1H-isoindol-4-yl]phenyl]acetamide?
The IUPAC name of N-[3-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-3-oxo-1H-isoindol-4-yl]phenyl]acetamide (CID 134809395) is N-[3-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-3-oxo-1H-isoindol-4-yl]phenyl]acetamide.
What is the SMILES notation for N-[3-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-3-oxo-1H-isoindol-4-yl]phenyl]acetamide?
The canonical SMILES for N-[3-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-3-oxo-1H-isoindol-4-yl]phenyl]acetamide is CC(=O)Nc1cccc(-c2cc(-c3c(C)noc3C)cc3c2C(=O)N(C)C3)c1.
What is the InChIKey of N-[3-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-3-oxo-1H-isoindol-4-yl]phenyl]acetamide?
The InChIKey is SCMVYKVAJXXRNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O3/c1-12-20(13(2)28-24-12)16-8-17-11-25(4)22(27)21(17)19(10-16)15-6-5-7-18(9-15)23-14(3)26/h5-10H,11H2,1-4H3,(H,23,26).
What are the key properties of N-[3-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-3-oxo-1H-isoindol-4-yl]phenyl]acetamide?
N-[3-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-3-oxo-1H-isoindol-4-yl]phenyl]acetamide has a molecular weight of 375.43 g/mol, XLogP of 4.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-3-oxo-1H-isoindol-4-yl]phenyl]acetamide is sourced from PubChem (CID 134809395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).