C22H20FN5O3 — CID 134809525
2-(1,3-benzodioxol-5-yl)-1-[2-(3-fluoroanilino)-5,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepin-8-yl]ethanone (PubChem CID 134809525) has the molecular formula C22H20FN5O3 and a molecular weight of 421.43 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1-[2-(3-fluoroanilino)-5,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepin-8-yl]ethanone.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1-[2-(3-fluoroanilino)-5,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepin-8-yl]ethanone |
|---|---|
| PubChem CID | 134809525 |
| Molecular Formula | C22H20FN5O3 |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1-[2-(3-fluoroanilino)-5,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepin-8-yl]ethanone |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)N1CCNc2cnc(Nc3cccc(F)c3)nc2C1 |
| InChI | InChI=1S/C22H20FN5O3/c23-15-2-1-3-16(10-15)26-22-25-11-17-18(27-22)12-28(7-6-24-17)21(29)9-14-4-5-19-20(8-14)31-13-30-19/h1-5,8,10-11,24H,6-7,9,12-13H2,(H,25,26,27) |
| InChIKey | DPDLRUFROUDVSJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |