C21H26N4O2 — CID 134809823
(4aS,9aS)-4-(2-pyridin-3-ylethyl)-7-(pyridin-2-ylmethyl)-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one (PubChem CID 134809823) has the molecular formula C21H26N4O2 and a molecular weight of 366.46 g/mol. Its IUPAC name is (4aS,9aS)-4-(2-pyridin-3-ylethyl)-7-(pyridin-2-ylmethyl)-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one.
| Compound Name | (4aS,9aS)-4-(2-pyridin-3-ylethyl)-7-(pyridin-2-ylmethyl)-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one |
|---|---|
| PubChem CID | 134809823 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (4aS,9aS)-4-(2-pyridin-3-ylethyl)-7-(pyridin-2-ylmethyl)-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one |
| SMILES | O=C1CO[C@H]2CCN(Cc3ccccn3)CC[C@@H]2N1CCc1cccnc1 |
| InChI | InChI=1S/C21H26N4O2/c26-21-16-27-20-8-12-24(15-18-5-1-2-10-23-18)11-7-19(20)25(21)13-6-17-4-3-9-22-14-17/h1-5,9-10,14,19-20H,6-8,11-13,15-16H2/t19-,20-/m0/s1 |
| InChIKey | TVALWCMCXKHXPF-PMACEKPBSA-N |
| XLogP | 1.91 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |