About (E)-1,1-dimethoxy-4-methylhex-3-ene
(E)-1,1-dimethoxy-4-methylhex-3-ene (PubChem CID 13480984) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is (E)-1,1-dimethoxy-4-methylhex-3-ene.
Molecular Properties
| Compound Name | (E)-1,1-dimethoxy-4-methylhex-3-ene |
| PubChem CID | 13480984 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | (E)-1,1-dimethoxy-4-methylhex-3-ene |
| SMILES | CC/C(C)=C/CC(OC)OC |
| InChI | InChI=1S/C9H18O2/c1-5-8(2)6-7-9(10-3)11-4/h6,9H,5,7H2,1-4H3/b8-6+ |
| InChIKey | YIOVSBUIQQSTHI-SOFGYWHQSA-N |
| XLogP | 2.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,1-dimethoxy-4-methylhex-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,1-dimethoxy-4-methylhex-3-ene?
The IUPAC name of (E)-1,1-dimethoxy-4-methylhex-3-ene (CID 13480984) is (E)-1,1-dimethoxy-4-methylhex-3-ene.
What is the SMILES notation for (E)-1,1-dimethoxy-4-methylhex-3-ene?
The canonical SMILES for (E)-1,1-dimethoxy-4-methylhex-3-ene is CC/C(C)=C/CC(OC)OC.
What is the InChIKey of (E)-1,1-dimethoxy-4-methylhex-3-ene?
The InChIKey is YIOVSBUIQQSTHI-SOFGYWHQSA-N. The full InChI is InChI=1S/C9H18O2/c1-5-8(2)6-7-9(10-3)11-4/h6,9H,5,7H2,1-4H3/b8-6+.
What are the key properties of (E)-1,1-dimethoxy-4-methylhex-3-ene?
(E)-1,1-dimethoxy-4-methylhex-3-ene has a molecular weight of 158.24 g/mol, XLogP of 2.35, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,1-dimethoxy-4-methylhex-3-ene is sourced from PubChem (CID 13480984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).