About 8-(1,5-dimethylpyrazol-4-yl)-6-methyl-2-(phenoxymethyl)imidazo[1,2-c]pyrimidin-5-one
8-(1,5-dimethylpyrazol-4-yl)-6-methyl-2-(phenoxymethyl)imidazo[1,2-c]pyrimidin-5-one (PubChem CID 134809847) has the molecular formula C19H19N5O2
and a molecular weight of 349.39 g/mol. Its IUPAC name is 8-(1,5-dimethylpyrazol-4-yl)-6-methyl-2-(phenoxymethyl)imidazo[1,2-c]pyrimidin-5-one.
Molecular Properties
| Compound Name | 8-(1,5-dimethylpyrazol-4-yl)-6-methyl-2-(phenoxymethyl)imidazo[1,2-c]pyrimidin-5-one |
| PubChem CID | 134809847 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 8-(1,5-dimethylpyrazol-4-yl)-6-methyl-2-(phenoxymethyl)imidazo[1,2-c]pyrimidin-5-one |
| SMILES | Cc1c(-c2cn(C)c(=O)n3cc(COc4ccccc4)nc23)cnn1C |
| InChI | InChI=1S/C19H19N5O2/c1-13-16(9-20-23(13)3)17-11-22(2)19(25)24-10-14(21-18(17)24)12-26-15-7-5-4-6-8-15/h4-11H,12H2,1-3H3 |
| InChIKey | ZOIRQOYHEUGWHB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 8-(1,5-dimethylpyrazol-4-yl)-6-methyl-2-(phenoxymethyl)imidazo[1,2-c]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1,5-dimethylpyrazol-4-yl)-6-methyl-2-(phenoxymethyl)imidazo[1,2-c]pyrimidin-5-one?
The IUPAC name of 8-(1,5-dimethylpyrazol-4-yl)-6-methyl-2-(phenoxymethyl)imidazo[1,2-c]pyrimidin-5-one (CID 134809847) is 8-(1,5-dimethylpyrazol-4-yl)-6-methyl-2-(phenoxymethyl)imidazo[1,2-c]pyrimidin-5-one.
What is the SMILES notation for 8-(1,5-dimethylpyrazol-4-yl)-6-methyl-2-(phenoxymethyl)imidazo[1,2-c]pyrimidin-5-one?
The canonical SMILES for 8-(1,5-dimethylpyrazol-4-yl)-6-methyl-2-(phenoxymethyl)imidazo[1,2-c]pyrimidin-5-one is Cc1c(-c2cn(C)c(=O)n3cc(COc4ccccc4)nc23)cnn1C.
What is the InChIKey of 8-(1,5-dimethylpyrazol-4-yl)-6-methyl-2-(phenoxymethyl)imidazo[1,2-c]pyrimidin-5-one?
The InChIKey is ZOIRQOYHEUGWHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N5O2/c1-13-16(9-20-23(13)3)17-11-22(2)19(25)24-10-14(21-18(17)24)12-26-15-7-5-4-6-8-15/h4-11H,12H2,1-3H3.
What are the key properties of 8-(1,5-dimethylpyrazol-4-yl)-6-methyl-2-(phenoxymethyl)imidazo[1,2-c]pyrimidin-5-one?
8-(1,5-dimethylpyrazol-4-yl)-6-methyl-2-(phenoxymethyl)imidazo[1,2-c]pyrimidin-5-one has a molecular weight of 349.39 g/mol, XLogP of 2.32, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1,5-dimethylpyrazol-4-yl)-6-methyl-2-(phenoxymethyl)imidazo[1,2-c]pyrimidin-5-one is sourced from PubChem (CID 134809847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).