About CID 134810028
CID 134810028 (PubChem CID 134810028) has the molecular formula C21H21N3O3S
and a molecular weight of 395.48 g/mol.
Molecular Properties
| Compound Name | CID 134810028 |
| PubChem CID | 134810028 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | — |
| SMILES | Cc1nn2c(c1-c1ccccc1[S+](C)(=O)[O-])N(C(=O)c1ccccc1)CCC2 |
| InChI | InChI=1S/C21H21N3O3S/c1-15-19(17-11-6-7-12-18(17)28(2,26)27)20-23(13-8-14-24(20)22-15)21(25)16-9-4-3-5-10-16/h3-7,9-12H,8,13-14H2,1-2H3 |
| InChIKey | IJZXNAMTCZGYTA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 134810028 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134810028?
The IUPAC name of CID 134810028 (CID 134810028) is not available.
What is the SMILES notation for CID 134810028?
The canonical SMILES for CID 134810028 is Cc1nn2c(c1-c1ccccc1[S+](C)(=O)[O-])N(C(=O)c1ccccc1)CCC2.
What is the InChIKey of CID 134810028?
The InChIKey is IJZXNAMTCZGYTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O3S/c1-15-19(17-11-6-7-12-18(17)28(2,26)27)20-23(13-8-14-24(20)22-15)21(25)16-9-4-3-5-10-16/h3-7,9-12H,8,13-14H2,1-2H3.
What are the key properties of CID 134810028?
CID 134810028 has a molecular weight of 395.48 g/mol, XLogP of 3.53, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134810028 is sourced from PubChem (CID 134810028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).